C21H25N5O2S — CID 111634327
3-[2-[[N-ethyl-N'-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]ethyl]-N-methylbenzamide (PubChem CID 111634327) has the molecular formula C21H25N5O2S and a molecular weight of 411.53 g/mol. Its IUPAC name is 3-[2-[[N-ethyl-N'-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]ethyl]-N-methylbenzamide.
| Compound Name | 3-[2-[[N-ethyl-N'-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 111634327 |
| Molecular Formula | C21H25N5O2S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 3-[2-[[N-ethyl-N'-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]ethyl]-N-methylbenzamide |
| SMILES | CCN/C(=N\Cc1coc(-c2cccs2)n1)NCCc1cccc(C(=O)NC)c1 |
| InChI | InChI=1S/C21H25N5O2S/c1-3-23-21(24-10-9-15-6-4-7-16(12-15)19(27)22-2)25-13-17-14-28-20(26-17)18-8-5-11-29-18/h4-8,11-12,14H,3,9-10,13H2,1-2H3,(H,22,27)(H2,23,24,25) |
| InChIKey | KLFXQUXQWBNJKB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|