C19H28IN5O2 — CID 111634020
3-[2-[[N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide (PubChem CID 111634020) has the molecular formula C19H28IN5O2 and a molecular weight of 485.37 g/mol. Its IUPAC name is 3-[2-[[N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide.
| Compound Name | 3-[2-[[N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111634020 |
| Molecular Formula | C19H28IN5O2 |
| Molecular Weight | 485.37 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 3-[2-[[N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(C)c(C)o1)NCCc1cccc(C(=O)NC)c1.I |
| InChI | InChI=1S/C19H27N5O2.HI/c1-5-21-19(23-12-17-24-13(2)14(3)26-17)22-10-9-15-7-6-8-16(11-15)18(25)20-4;/h6-8,11H,5,9-10,12H2,1-4H3,(H,20,25)(H2,21,22,23);1H |
| InChIKey | HLQBYAREEGNNIC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|