C22H26N4O2 — CID 111633217
3-[2-[[N'-(1-benzofuran-2-ylmethyl)-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide (PubChem CID 111633217) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 3-[2-[[N'-(1-benzofuran-2-ylmethyl)-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide.
| Compound Name | 3-[2-[[N'-(1-benzofuran-2-ylmethyl)-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 111633217 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 3-[2-[[N'-(1-benzofuran-2-ylmethyl)-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide |
| SMILES | CCN/C(=N\Cc1cc2ccccc2o1)NCCc1cccc(C(=O)NC)c1 |
| InChI | InChI=1S/C22H26N4O2/c1-3-24-22(26-15-19-14-17-8-4-5-10-20(17)28-19)25-12-11-16-7-6-9-18(13-16)21(27)23-2/h4-10,13-14H,3,11-12,15H2,1-2H3,(H,23,27)(H2,24,25,26) |
| InChIKey | DJXQIXZZWCPQLD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|