C17H22N6S — CID 111535580
1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methylguanidine (PubChem CID 111535580) has the molecular formula C17H22N6S and a molecular weight of 342.47 g/mol. Its IUPAC name is 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methylguanidine.
| Compound Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111535580 |
| Molecular Formula | C17H22N6S |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methylguanidine |
| SMILES | CCc1cnc(CN/C(=N\C)NCCc2cn3ccccc3n2)s1 |
| InChI | InChI=1S/C17H22N6S/c1-3-14-10-20-16(24-14)11-21-17(18-2)19-8-7-13-12-23-9-5-4-6-15(23)22-13/h4-6,9-10,12H,3,7-8,11H2,1-2H3,(H2,18,19,21) |
| InChIKey | MCHGXSOVTCGMKR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|