C16H21N7S — CID 111533763
1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine (PubChem CID 111533763) has the molecular formula C16H21N7S and a molecular weight of 343.46 g/mol. Its IUPAC name is 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine.
| Compound Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111533763 |
| Molecular Formula | C16H21N7S |
| Molecular Weight | 343.46 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine |
| SMILES | CCc1cnc(CN/C(=N\C)NCCc2nnc3ccccn23)s1 |
| InChI | InChI=1S/C16H21N7S/c1-3-12-10-19-15(24-12)11-20-16(17-2)18-8-7-14-22-21-13-6-4-5-9-23(13)14/h4-6,9-10H,3,7-8,11H2,1-2H3,(H2,17,18,20) |
| InChIKey | XZCGUUZZANDVMY-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 79.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.46 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|