C15H21IN6S2 — CID 111531472
1-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methylguanidine;hydroiodide (PubChem CID 111531472) has the molecular formula C15H21IN6S2 and a molecular weight of 476.41 g/mol. Its IUPAC name is 1-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111531472 |
| Molecular Formula | C15H21IN6S2 |
| Molecular Weight | 476.41 g/mol |
| Exact Mass | 476.03 |
| IUPAC Name | 1-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methylguanidine;hydroiodide |
| SMILES | CCc1cnc(CCN/C(=N\C)NCc2cn3ccsc3n2)s1.I |
| InChI | InChI=1S/C15H20N6S2.HI/c1-3-12-9-18-13(23-12)4-5-17-14(16-2)19-8-11-10-21-6-7-22-15(21)20-11;/h6-7,9-10H,3-5,8H2,1-2H3,(H2,16,17,19);1H |
| InChIKey | LXTGZOAZUUASQQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|