C14H21IN8S — CID 111701014
1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methylguanidine;hydroiodide (PubChem CID 111701014) has the molecular formula C14H21IN8S and a molecular weight of 460.35 g/mol. Its IUPAC name is 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111701014 |
| Molecular Formula | C14H21IN8S |
| Molecular Weight | 460.35 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methylguanidine;hydroiodide |
| SMILES | CCc1nncn1CCN/C(=N\C)NCc1cn2ccsc2n1.I |
| InChI | InChI=1S/C14H20N8S.HI/c1-3-12-20-18-10-22(12)5-4-16-13(15-2)17-8-11-9-21-6-7-23-14(21)19-11;/h6-7,9-10H,3-5,8H2,1-2H3,(H2,15,16,17);1H |
| InChIKey | USXXTGWXFHNTMH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|