C12H23IN4S — CID 111510323
1-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methyl-3-propan-2-ylguanidine;hydroiodide (PubChem CID 111510323) has the molecular formula C12H23IN4S and a molecular weight of 382.32 g/mol. Its IUPAC name is 1-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methyl-3-propan-2-ylguanidine;hydroiodide.
| Compound Name | 1-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methyl-3-propan-2-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111510323 |
| Molecular Formula | C12H23IN4S |
| Molecular Weight | 382.32 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 1-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methyl-3-propan-2-ylguanidine;hydroiodide |
| SMILES | CCc1cnc(CCN/C(=N/C)NC(C)C)s1.I |
| InChI | InChI=1S/C12H22N4S.HI/c1-5-10-8-15-11(17-10)6-7-14-12(13-4)16-9(2)3;/h8-9H,5-7H2,1-4H3,(H2,13,14,16);1H |
| InChIKey | WPQPWVQUEQNZSC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|