C15H28N4OS — CID 111531371
1-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methyl-3-[2-(2-methylpropoxy)ethyl]guanidine (PubChem CID 111531371) has the molecular formula C15H28N4OS and a molecular weight of 312.48 g/mol. Its IUPAC name is 1-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methyl-3-[2-(2-methylpropoxy)ethyl]guanidine.
| Compound Name | 1-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methyl-3-[2-(2-methylpropoxy)ethyl]guanidine |
|---|---|
| PubChem CID | 111531371 |
| Molecular Formula | C15H28N4OS |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 1-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methyl-3-[2-(2-methylpropoxy)ethyl]guanidine |
| SMILES | CCc1cnc(CCN/C(=N/C)NCCOCC(C)C)s1 |
| InChI | InChI=1S/C15H28N4OS/c1-5-13-10-19-14(21-13)6-7-17-15(16-4)18-8-9-20-11-12(2)3/h10,12H,5-9,11H2,1-4H3,(H2,16,17,18) |
| InChIKey | PLPSRBOKUUQETK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|