C18H24F3IN4S — CID 111515962
1-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methyl-3-[1-[3-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide (PubChem CID 111515962) has the molecular formula C18H24F3IN4S and a molecular weight of 512.38 g/mol. Its IUPAC name is 1-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methyl-3-[1-[3-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methyl-3-[1-[3-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111515962 |
| Molecular Formula | C18H24F3IN4S |
| Molecular Weight | 512.38 g/mol |
| Exact Mass | 512.07 |
| IUPAC Name | 1-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methyl-3-[1-[3-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide |
| SMILES | CCc1cnc(CCN/C(=N\C)NC(C)c2cccc(C(F)(F)F)c2)s1.I |
| InChI | InChI=1S/C18H23F3N4S.HI/c1-4-15-11-24-16(26-15)8-9-23-17(22-3)25-12(2)13-6-5-7-14(10-13)18(19,20)21;/h5-7,10-12H,4,8-9H2,1-3H3,(H2,22,23,25);1H |
| InChIKey | NICZTTWYKRERDQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.38 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|