C17H24BrIN4S — CID 111515796
1-[1-(2-bromophenyl)ethyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111515796) has the molecular formula C17H24BrIN4S and a molecular weight of 523.28 g/mol. Its IUPAC name is 1-[1-(2-bromophenyl)ethyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[1-(2-bromophenyl)ethyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111515796 |
| Molecular Formula | C17H24BrIN4S |
| Molecular Weight | 523.28 g/mol |
| Exact Mass | 521.99 |
| IUPAC Name | 1-[1-(2-bromophenyl)ethyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCc1cnc(CCN/C(=N\C)NC(C)c2ccccc2Br)s1.I |
| InChI | InChI=1S/C17H23BrN4S.HI/c1-4-13-11-21-16(23-13)9-10-20-17(19-3)22-12(2)14-7-5-6-8-15(14)18;/h5-8,11-12H,4,9-10H2,1-3H3,(H2,19,20,22);1H |
| InChIKey | BSWOTGYLSBZYOC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.28 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|