C17H26F3IN4O — CID 111324103
2-methyl-N-[2-[[N'-methyl-N-[1-[3-(trifluoromethyl)phenyl]ethyl]carbamimidoyl]amino]ethyl]propanamide;hydroiodide (PubChem CID 111324103) has the molecular formula C17H26F3IN4O and a molecular weight of 486.32 g/mol. Its IUPAC name is 2-methyl-N-[2-[[N'-methyl-N-[1-[3-(trifluoromethyl)phenyl]ethyl]carbamimidoyl]amino]ethyl]propanamide;hydroiodide.
| Compound Name | 2-methyl-N-[2-[[N'-methyl-N-[1-[3-(trifluoromethyl)phenyl]ethyl]carbamimidoyl]amino]ethyl]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111324103 |
| Molecular Formula | C17H26F3IN4O |
| Molecular Weight | 486.32 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | 2-methyl-N-[2-[[N'-methyl-N-[1-[3-(trifluoromethyl)phenyl]ethyl]carbamimidoyl]amino]ethyl]propanamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)C(C)C)NC(C)c1cccc(C(F)(F)F)c1.I |
| InChI | InChI=1S/C17H25F3N4O.HI/c1-11(2)15(25)22-8-9-23-16(21-4)24-12(3)13-6-5-7-14(10-13)17(18,19)20;/h5-7,10-12H,8-9H2,1-4H3,(H,22,25)(H2,21,23,24);1H |
| InChIKey | ROSQUOOXHOCUSD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|