C17H15ClF3NO — CID 42907102
2-(2-chlorophenyl)-N-[1-[3-(trifluoromethyl)phenyl]ethyl]acetamide (PubChem CID 42907102) has the molecular formula C17H15ClF3NO and a molecular weight of 341.76 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[1-[3-(trifluoromethyl)phenyl]ethyl]acetamide.
| Compound Name | 2-(2-chlorophenyl)-N-[1-[3-(trifluoromethyl)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 42907102 |
| Molecular Formula | C17H15ClF3NO |
| Molecular Weight | 341.76 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[1-[3-(trifluoromethyl)phenyl]ethyl]acetamide |
| SMILES | CC(NC(=O)Cc1ccccc1Cl)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H15ClF3NO/c1-11(12-6-4-7-14(9-12)17(19,20)21)22-16(23)10-13-5-2-3-8-15(13)18/h2-9,11H,10H2,1H3,(H,22,23) |
| InChIKey | FJWCTNPWCPFWHE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.76 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |