C21H18F3NO — CID 8025350
N-[(1R)-1-naphthalen-2-ylethyl]-2-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 8025350) has the molecular formula C21H18F3NO and a molecular weight of 357.38 g/mol. Its IUPAC name is N-[(1R)-1-naphthalen-2-ylethyl]-2-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[(1R)-1-naphthalen-2-ylethyl]-2-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 8025350 |
| Molecular Formula | C21H18F3NO |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | N-[(1R)-1-naphthalen-2-ylethyl]-2-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | C[C@@H](NC(=O)Cc1cccc(C(F)(F)F)c1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H18F3NO/c1-14(17-10-9-16-6-2-3-7-18(16)13-17)25-20(26)12-15-5-4-8-19(11-15)21(22,23)24/h2-11,13-14H,12H2,1H3,(H,25,26)/t14-/m1/s1 |
| InChIKey | DVISFRJQJFTZQH-CQSZACIVSA-N |
| XLogP | 5.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |