C19H20F3NO2 — CID 26010093
2-(4-ethoxyphenyl)-N-[(1S)-1-[3-(trifluoromethyl)phenyl]ethyl]acetamide (PubChem CID 26010093) has the molecular formula C19H20F3NO2 and a molecular weight of 351.37 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-N-[(1S)-1-[3-(trifluoromethyl)phenyl]ethyl]acetamide.
| Compound Name | 2-(4-ethoxyphenyl)-N-[(1S)-1-[3-(trifluoromethyl)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 26010093 |
| Molecular Formula | C19H20F3NO2 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 2-(4-ethoxyphenyl)-N-[(1S)-1-[3-(trifluoromethyl)phenyl]ethyl]acetamide |
| SMILES | CCOc1ccc(CC(=O)N[C@@H](C)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C19H20F3NO2/c1-3-25-17-9-7-14(8-10-17)11-18(24)23-13(2)15-5-4-6-16(12-15)19(20,21)22/h4-10,12-13H,3,11H2,1-2H3,(H,23,24)/t13-/m0/s1 |
| InChIKey | QJABRPIBFKOHJT-ZDUSSCGKSA-N |
| XLogP | 4.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |