C18H17F3N2O3 — CID 41188273
4-(2-amino-2-oxoethoxy)-N-[(1S)-1-[3-(trifluoromethyl)phenyl]ethyl]benzamide (PubChem CID 41188273) has the molecular formula C18H17F3N2O3 and a molecular weight of 366.34 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethoxy)-N-[(1S)-1-[3-(trifluoromethyl)phenyl]ethyl]benzamide.
| Compound Name | 4-(2-amino-2-oxoethoxy)-N-[(1S)-1-[3-(trifluoromethyl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 41188273 |
| Molecular Formula | C18H17F3N2O3 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 4-(2-amino-2-oxoethoxy)-N-[(1S)-1-[3-(trifluoromethyl)phenyl]ethyl]benzamide |
| SMILES | C[C@H](NC(=O)c1ccc(OCC(N)=O)cc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H17F3N2O3/c1-11(13-3-2-4-14(9-13)18(19,20)21)23-17(25)12-5-7-15(8-6-12)26-10-16(22)24/h2-9,11H,10H2,1H3,(H2,22,24)(H,23,25)/t11-/m0/s1 |
| InChIKey | BINNKAHWMWAMEL-NSHDSACASA-N |
| XLogP | 3.06 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |