C18H29N5 — CID 111890477
1-ethyl-2-(2-ethylbutyl)-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)guanidine (PubChem CID 111890477) has the molecular formula C18H29N5 and a molecular weight of 315.46 g/mol. Its IUPAC name is 1-ethyl-2-(2-ethylbutyl)-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)guanidine.
| Compound Name | 1-ethyl-2-(2-ethylbutyl)-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111890477 |
| Molecular Formula | C18H29N5 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.24 |
| IUPAC Name | 1-ethyl-2-(2-ethylbutyl)-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC(CC)CC)NCCc1cn2ccccc2n1 |
| InChI | InChI=1S/C18H29N5/c1-4-15(5-2)13-21-18(19-6-3)20-11-10-16-14-23-12-8-7-9-17(23)22-16/h7-9,12,14-15H,4-6,10-11,13H2,1-3H3,(H2,19,20,21) |
| InChIKey | GLPBGROBSCLCRY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 53.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|