C23H29N7 — CID 111352270
1-ethyl-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine (PubChem CID 111352270) has the molecular formula C23H29N7 and a molecular weight of 403.53 g/mol. Its IUPAC name is 1-ethyl-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine.
| Compound Name | 1-ethyl-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111352270 |
| Molecular Formula | C23H29N7 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | 1-ethyl-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CCCn1c(C)nc2ccccc21)NCCc1cn2ccccc2n1 |
| InChI | InChI=1S/C23H29N7/c1-3-24-23(26-14-12-19-17-29-15-7-6-11-22(29)28-19)25-13-8-16-30-18(2)27-20-9-4-5-10-21(20)30/h4-7,9-11,15,17H,3,8,12-14,16H2,1-2H3,(H2,24,25,26) |
| InChIKey | VLXXIFOWKRAAOB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|