C22H30N6 — CID 109402673
1-ethyl-2-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[2-(3-methyl-4-pyridinyl)ethyl]guanidine (PubChem CID 109402673) has the molecular formula C22H30N6 and a molecular weight of 378.52 g/mol. Its IUPAC name is 1-ethyl-2-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[2-(3-methyl-4-pyridinyl)ethyl]guanidine.
| Compound Name | 1-ethyl-2-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[2-(3-methyl-4-pyridinyl)ethyl]guanidine |
|---|---|
| PubChem CID | 109402673 |
| Molecular Formula | C22H30N6 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | 1-ethyl-2-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[2-(3-methyl-4-pyridinyl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCCn1c(C)nc2ccccc21)NCCc1ccncc1C |
| InChI | InChI=1S/C22H30N6/c1-4-24-22(26-14-11-19-10-13-23-16-17(19)2)25-12-7-15-28-18(3)27-20-8-5-6-9-21(20)28/h5-6,8-10,13,16H,4,7,11-12,14-15H2,1-3H3,(H2,24,25,26) |
| InChIKey | WGPWSQVATVMSMU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|