C20H29N7 — CID 111766545
1-ethyl-2-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[2-(4-methylpyrazol-1-yl)ethyl]guanidine (PubChem CID 111766545) has the molecular formula C20H29N7 and a molecular weight of 367.50 g/mol. Its IUPAC name is 1-ethyl-2-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[2-(4-methylpyrazol-1-yl)ethyl]guanidine.
| Compound Name | 1-ethyl-2-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[2-(4-methylpyrazol-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111766545 |
| Molecular Formula | C20H29N7 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | 1-ethyl-2-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[2-(4-methylpyrazol-1-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCCn1c(C)nc2ccccc21)NCCn1cc(C)cn1 |
| InChI | InChI=1S/C20H29N7/c1-4-21-20(23-11-13-26-15-16(2)14-24-26)22-10-7-12-27-17(3)25-18-8-5-6-9-19(18)27/h5-6,8-9,14-15H,4,7,10-13H2,1-3H3,(H2,21,22,23) |
| InChIKey | MMZIHHHELQPLPQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|