C19H33N5O2S — CID 111832279
2-methyl-1-[3-(oxolan-2-ylmethoxy)propyl]-3-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]guanidine (PubChem CID 111832279) has the molecular formula C19H33N5O2S and a molecular weight of 395.57 g/mol. Its IUPAC name is 2-methyl-1-[3-(oxolan-2-ylmethoxy)propyl]-3-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]guanidine.
| Compound Name | 2-methyl-1-[3-(oxolan-2-ylmethoxy)propyl]-3-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111832279 |
| Molecular Formula | C19H33N5O2S |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | 2-methyl-1-[3-(oxolan-2-ylmethoxy)propyl]-3-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]guanidine |
| SMILES | C/N=C(\NCCCOCC1CCCO1)NCCc1csc(N2CCCC2)n1 |
| InChI | InChI=1S/C19H33N5O2S/c1-20-18(21-8-5-12-25-14-17-6-4-13-26-17)22-9-7-16-15-27-19(23-16)24-10-2-3-11-24/h15,17H,2-14H2,1H3,(H2,20,21,22) |
| InChIKey | WPKFJCXIAUMOCE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|