C17H23BrN6 — CID 119150165
1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-(1-cyclopropylpyrrolidin-3-yl)-2-methylguanidine (PubChem CID 119150165) has the molecular formula C17H23BrN6 and a molecular weight of 391.32 g/mol. Its IUPAC name is 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-(1-cyclopropylpyrrolidin-3-yl)-2-methylguanidine.
| Compound Name | 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-(1-cyclopropylpyrrolidin-3-yl)-2-methylguanidine |
|---|---|
| PubChem CID | 119150165 |
| Molecular Formula | C17H23BrN6 |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-(1-cyclopropylpyrrolidin-3-yl)-2-methylguanidine |
| SMILES | C/N=C(\NCc1cn2cc(Br)ccc2n1)NC1CCN(C2CC2)C1 |
| InChI | InChI=1S/C17H23BrN6/c1-19-17(22-13-6-7-23(10-13)15-3-4-15)20-8-14-11-24-9-12(18)2-5-16(24)21-14/h2,5,9,11,13,15H,3-4,6-8,10H2,1H3,(H2,19,20,22) |
| InChIKey | WNRAVQVBJIGZRZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 56.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|