C22H32N4O — CID 109476770
1-ethyl-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]-2-(isoquinolin-1-ylmethyl)guanidine (PubChem CID 109476770) has the molecular formula C22H32N4O and a molecular weight of 368.52 g/mol. Its IUPAC name is 1-ethyl-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]-2-(isoquinolin-1-ylmethyl)guanidine.
| Compound Name | 1-ethyl-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]-2-(isoquinolin-1-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109476770 |
| Molecular Formula | C22H32N4O |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | 1-ethyl-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]-2-(isoquinolin-1-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1nccc2ccccc12)NCC1(CCO)CCCCC1 |
| InChI | InChI=1S/C22H32N4O/c1-2-23-21(26-17-22(13-15-27)11-6-3-7-12-22)25-16-20-19-9-5-4-8-18(19)10-14-24-20/h4-5,8-10,14,27H,2-3,6-7,11-13,15-17H2,1H3,(H2,23,25,26) |
| InChIKey | JZTIOVNAMBPPEO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|