C18H31N3OS — CID 109477212
1-ethyl-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]-2-[(5-methylthiophen-2-yl)methyl]guanidine (PubChem CID 109477212) has the molecular formula C18H31N3OS and a molecular weight of 337.53 g/mol. Its IUPAC name is 1-ethyl-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]-2-[(5-methylthiophen-2-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]-2-[(5-methylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109477212 |
| Molecular Formula | C18H31N3OS |
| Molecular Weight | 337.53 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | 1-ethyl-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]-2-[(5-methylthiophen-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(C)s1)NCC1(CCO)CCCCC1 |
| InChI | InChI=1S/C18H31N3OS/c1-3-19-17(20-13-16-8-7-15(2)23-16)21-14-18(11-12-22)9-5-4-6-10-18/h7-8,22H,3-6,9-14H2,1-2H3,(H2,19,20,21) |
| InChIKey | IMLOQWOUYPPNQO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.53 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|