C19H33IN4O2S — CID 109470421
2-[[2-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-[(1-ethylcyclobutyl)methyl]guanidine;hydroiodide (PubChem CID 109470421) has the molecular formula C19H33IN4O2S and a molecular weight of 508.47 g/mol. Its IUPAC name is 2-[[2-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-[(1-ethylcyclobutyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-[[2-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-[(1-ethylcyclobutyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109470421 |
| Molecular Formula | C19H33IN4O2S |
| Molecular Weight | 508.47 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | 2-[[2-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-[(1-ethylcyclobutyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1S(=O)(=O)N(C)C)NCC1(CC)CCC1.I |
| InChI | InChI=1S/C19H32N4O2S.HI/c1-5-19(12-9-13-19)15-22-18(20-6-2)21-14-16-10-7-8-11-17(16)26(24,25)23(3)4;/h7-8,10-11H,5-6,9,12-15H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | RCSKRBZDFDBUNI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|