C15H29IN4O2S3 — CID 111609663
2-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-1-ethyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide (PubChem CID 111609663) has the molecular formula C15H29IN4O2S3 and a molecular weight of 520.53 g/mol. Its IUPAC name is 2-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-1-ethyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide.
| Compound Name | 2-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-1-ethyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111609663 |
| Molecular Formula | C15H29IN4O2S3 |
| Molecular Weight | 520.53 g/mol |
| Exact Mass | 520.05 |
| IUPAC Name | 2-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-1-ethyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(S(=O)(=O)N(C)C)s1)NCC(C)(C)SC.I |
| InChI | InChI=1S/C15H28N4O2S3.HI/c1-7-16-14(18-11-15(2,3)22-6)17-10-12-8-9-13(23-12)24(20,21)19(4)5;/h8-9H,7,10-11H2,1-6H3,(H2,16,17,18);1H |
| InChIKey | PBEYYGOQPBRILN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|