C18H26FIN4O2S2 — CID 111625097
1-ethyl-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111625097) has the molecular formula C18H26FIN4O2S2 and a molecular weight of 540.47 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111625097 |
| Molecular Formula | C18H26FIN4O2S2 |
| Molecular Weight | 540.47 g/mol |
| Exact Mass | 540.05 |
| IUPAC Name | 1-ethyl-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(S(N)(=O)=O)s1)NCC(C)(C)c1cccc(F)c1.I |
| InChI | InChI=1S/C18H25FN4O2S2.HI/c1-4-21-17(22-11-15-8-9-16(26-15)27(20,24)25)23-12-18(2,3)13-6-5-7-14(19)10-13;/h5-10H,4,11-12H2,1-3H3,(H2,20,24,25)(H2,21,22,23);1H |
| InChIKey | STJGFYIJRSCEOM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|