C15H20FIN4O2S2 — CID 111264558
1-ethyl-2-[(2-fluorophenyl)methyl]-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111264558) has the molecular formula C15H20FIN4O2S2 and a molecular weight of 498.39 g/mol. Its IUPAC name is 1-ethyl-2-[(2-fluorophenyl)methyl]-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(2-fluorophenyl)methyl]-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111264558 |
| Molecular Formula | C15H20FIN4O2S2 |
| Molecular Weight | 498.39 g/mol |
| Exact Mass | 498.01 |
| IUPAC Name | 1-ethyl-2-[(2-fluorophenyl)methyl]-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1F)NCc1ccc(S(N)(=O)=O)s1.I |
| InChI | InChI=1S/C15H19FN4O2S2.HI/c1-2-18-15(19-9-11-5-3-4-6-13(11)16)20-10-12-7-8-14(23-12)24(17,21)22;/h3-8H,2,9-10H2,1H3,(H2,17,21,22)(H2,18,19,20);1H |
| InChIKey | PFFOWELPLZVYOY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|