C13H20N6O2S2 — CID 111954899
1-ethyl-2-[(2-methylpyrazol-3-yl)methyl]-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine (PubChem CID 111954899) has the molecular formula C13H20N6O2S2 and a molecular weight of 356.48 g/mol. Its IUPAC name is 1-ethyl-2-[(2-methylpyrazol-3-yl)methyl]-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine.
| Compound Name | 1-ethyl-2-[(2-methylpyrazol-3-yl)methyl]-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111954899 |
| Molecular Formula | C13H20N6O2S2 |
| Molecular Weight | 356.48 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 1-ethyl-2-[(2-methylpyrazol-3-yl)methyl]-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccnn1C)NCc1ccc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C13H20N6O2S2/c1-3-15-13(16-8-10-6-7-18-19(10)2)17-9-11-4-5-12(22-11)23(14,20)21/h4-7H,3,8-9H2,1-2H3,(H2,14,20,21)(H2,15,16,17) |
| InChIKey | IDOYYLCTQZEVEE-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.48 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|