C14H23N7O2S2 — CID 111705679
1-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-3-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 111705679) has the molecular formula C14H23N7O2S2 and a molecular weight of 385.52 g/mol. Its IUPAC name is 1-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-3-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 1-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-3-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111705679 |
| Molecular Formula | C14H23N7O2S2 |
| Molecular Weight | 385.52 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 1-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-3-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ncnn1C)NCc1ccc(S(=O)(=O)N(C)C)s1 |
| InChI | InChI=1S/C14H23N7O2S2/c1-5-15-14(17-9-12-18-10-19-21(12)4)16-8-11-6-7-13(24-11)25(22,23)20(2)3/h6-7,10H,5,8-9H2,1-4H3,(H2,15,16,17) |
| InChIKey | WPPBSILVKWKRPQ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 104.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.52 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|