C15H26IN7O — CID 111705274
1-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111705274) has the molecular formula C15H26IN7O and a molecular weight of 447.33 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111705274 |
| Molecular Formula | C15H26IN7O |
| Molecular Weight | 447.33 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 1-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ncnn1C)NCC(c1ccco1)N(C)C.I |
| InChI | InChI=1S/C15H25N7O.HI/c1-5-16-15(18-10-14-19-11-20-22(14)4)17-9-12(21(2)3)13-7-6-8-23-13;/h6-8,11-12H,5,9-10H2,1-4H3,(H2,16,17,18);1H |
| InChIKey | IZAHXUKSIKHYBQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 83.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|