C9H19IN6 — CID 111705638
3-ethyl-1,1-dimethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111705638) has the molecular formula C9H19IN6 and a molecular weight of 338.20 g/mol. Its IUPAC name is 3-ethyl-1,1-dimethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1,1-dimethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111705638 |
| Molecular Formula | C9H19IN6 |
| Molecular Weight | 338.20 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 3-ethyl-1,1-dimethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N/Cc1ncnn1C)N(C)C.I |
| InChI | InChI=1S/C9H18N6.HI/c1-5-10-9(14(2)3)11-6-8-12-7-13-15(8)4;/h7H,5-6H2,1-4H3,(H,10,11);1H |
| InChIKey | LIIHZOCVXRDFSM-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.20 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|