C14H21N7OS — CID 111707279
N,N-dimethyl-2-[[N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]-N-(thiophen-2-ylmethyl)carbamimidoyl]amino]acetamide (PubChem CID 111707279) has the molecular formula C14H21N7OS and a molecular weight of 335.44 g/mol. Its IUPAC name is N,N-dimethyl-2-[[N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]-N-(thiophen-2-ylmethyl)carbamimidoyl]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]-N-(thiophen-2-ylmethyl)carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111707279 |
| Molecular Formula | C14H21N7OS |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | N,N-dimethyl-2-[[N'-[(2-methyl-1,2,4-triazol-3-yl)methyl]-N-(thiophen-2-ylmethyl)carbamimidoyl]amino]acetamide |
| SMILES | CN(C)C(=O)CN/C(=N\Cc1ncnn1C)NCc1cccs1 |
| InChI | InChI=1S/C14H21N7OS/c1-20(2)13(22)9-17-14(15-7-11-5-4-6-23-11)16-8-12-18-10-19-21(12)3/h4-6,10H,7-9H2,1-3H3,(H2,15,16,17) |
| InChIKey | IGDJULAYUNUUSA-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|