C17H23N5OS — CID 111493950
N,N-dimethyl-2-[[N'-(pyridin-2-ylmethyl)-N-(2-thiophen-2-ylethyl)carbamimidoyl]amino]acetamide (PubChem CID 111493950) has the molecular formula C17H23N5OS and a molecular weight of 345.47 g/mol. Its IUPAC name is N,N-dimethyl-2-[[N'-(pyridin-2-ylmethyl)-N-(2-thiophen-2-ylethyl)carbamimidoyl]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[N'-(pyridin-2-ylmethyl)-N-(2-thiophen-2-ylethyl)carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111493950 |
| Molecular Formula | C17H23N5OS |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | N,N-dimethyl-2-[[N'-(pyridin-2-ylmethyl)-N-(2-thiophen-2-ylethyl)carbamimidoyl]amino]acetamide |
| SMILES | CN(C)C(=O)CN/C(=N/Cc1ccccn1)NCCc1cccs1 |
| InChI | InChI=1S/C17H23N5OS/c1-22(2)16(23)13-21-17(19-10-8-15-7-5-11-24-15)20-12-14-6-3-4-9-18-14/h3-7,9,11H,8,10,12-13H2,1-2H3,(H2,19,20,21) |
| InChIKey | ZMTJFFVHZUDJJH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|