C22H28N6OS — CID 110035243
N,N-dimethyl-2-[[N'-[(1-methyl-3-phenylpyrazol-4-yl)methyl]-N-(2-thiophen-2-ylethyl)carbamimidoyl]amino]acetamide (PubChem CID 110035243) has the molecular formula C22H28N6OS and a molecular weight of 424.57 g/mol. Its IUPAC name is N,N-dimethyl-2-[[N'-[(1-methyl-3-phenylpyrazol-4-yl)methyl]-N-(2-thiophen-2-ylethyl)carbamimidoyl]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[N'-[(1-methyl-3-phenylpyrazol-4-yl)methyl]-N-(2-thiophen-2-ylethyl)carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 110035243 |
| Molecular Formula | C22H28N6OS |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | N,N-dimethyl-2-[[N'-[(1-methyl-3-phenylpyrazol-4-yl)methyl]-N-(2-thiophen-2-ylethyl)carbamimidoyl]amino]acetamide |
| SMILES | CN(C)C(=O)CN/C(=N/Cc1cn(C)nc1-c1ccccc1)NCCc1cccs1 |
| InChI | InChI=1S/C22H28N6OS/c1-27(2)20(29)15-25-22(23-12-11-19-10-7-13-30-19)24-14-18-16-28(3)26-21(18)17-8-5-4-6-9-17/h4-10,13,16H,11-12,14-15H2,1-3H3,(H2,23,24,25) |
| InChIKey | UXNBQTAHMNNZAK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|