C20H29IN4O3S — CID 111863080
2-[[N'-[(2,4-dimethoxyphenyl)methyl]-N-(2-thiophen-2-ylethyl)carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111863080) has the molecular formula C20H29IN4O3S and a molecular weight of 532.45 g/mol. Its IUPAC name is 2-[[N'-[(2,4-dimethoxyphenyl)methyl]-N-(2-thiophen-2-ylethyl)carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[N'-[(2,4-dimethoxyphenyl)methyl]-N-(2-thiophen-2-ylethyl)carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111863080 |
| Molecular Formula | C20H29IN4O3S |
| Molecular Weight | 532.45 g/mol |
| Exact Mass | 532.10 |
| IUPAC Name | 2-[[N'-[(2,4-dimethoxyphenyl)methyl]-N-(2-thiophen-2-ylethyl)carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | COc1ccc(C/N=C(\NCCc2cccs2)NCC(=O)N(C)C)c(OC)c1.I |
| InChI | InChI=1S/C20H28N4O3S.HI/c1-24(2)19(25)14-23-20(21-10-9-17-6-5-11-28-17)22-13-15-7-8-16(26-3)12-18(15)27-4;/h5-8,11-12H,9-10,13-14H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | ZLWQRIRZGFASLW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|