C17H29IN4O4 — CID 111544778
2-[[N'-[(2,4-dimethoxyphenyl)methyl]-N-(2-methoxyethyl)carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111544778) has the molecular formula C17H29IN4O4 and a molecular weight of 480.35 g/mol. Its IUPAC name is 2-[[N'-[(2,4-dimethoxyphenyl)methyl]-N-(2-methoxyethyl)carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[N'-[(2,4-dimethoxyphenyl)methyl]-N-(2-methoxyethyl)carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111544778 |
| Molecular Formula | C17H29IN4O4 |
| Molecular Weight | 480.35 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 2-[[N'-[(2,4-dimethoxyphenyl)methyl]-N-(2-methoxyethyl)carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | COCCN/C(=N\Cc1ccc(OC)cc1OC)NCC(=O)N(C)C.I |
| InChI | InChI=1S/C17H28N4O4.HI/c1-21(2)16(22)12-20-17(18-8-9-23-3)19-11-13-6-7-14(24-4)10-15(13)25-5;/h6-7,10H,8-9,11-12H2,1-5H3,(H2,18,19,20);1H |
| InChIKey | OUPOQQKEROVNHB-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.35 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|