C16H22BrF3N4O2 — CID 110034971
2-[[N'-[[4-bromo-2-(trifluoromethyl)phenyl]methyl]-N-(2-methoxyethyl)carbamimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 110034971) has the molecular formula C16H22BrF3N4O2 and a molecular weight of 439.28 g/mol. Its IUPAC name is 2-[[N'-[[4-bromo-2-(trifluoromethyl)phenyl]methyl]-N-(2-methoxyethyl)carbamimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[N'-[[4-bromo-2-(trifluoromethyl)phenyl]methyl]-N-(2-methoxyethyl)carbamimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110034971 |
| Molecular Formula | C16H22BrF3N4O2 |
| Molecular Weight | 439.28 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 2-[[N'-[[4-bromo-2-(trifluoromethyl)phenyl]methyl]-N-(2-methoxyethyl)carbamimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | COCCN/C(=N\Cc1ccc(Br)cc1C(F)(F)F)NCC(=O)N(C)C |
| InChI | InChI=1S/C16H22BrF3N4O2/c1-24(2)14(25)10-23-15(21-6-7-26-3)22-9-11-4-5-12(17)8-13(11)16(18,19)20/h4-5,8H,6-7,9-10H2,1-3H3,(H2,21,22,23) |
| InChIKey | YOFSJRBLUOSYOJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|