C17H25BrN4O — CID 111786029
2-[[N'-[(4-bromo-2-methylphenyl)methyl]-N-(2-methylprop-2-enyl)carbamimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 111786029) has the molecular formula C17H25BrN4O and a molecular weight of 381.32 g/mol. Its IUPAC name is 2-[[N'-[(4-bromo-2-methylphenyl)methyl]-N-(2-methylprop-2-enyl)carbamimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[N'-[(4-bromo-2-methylphenyl)methyl]-N-(2-methylprop-2-enyl)carbamimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111786029 |
| Molecular Formula | C17H25BrN4O |
| Molecular Weight | 381.32 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 2-[[N'-[(4-bromo-2-methylphenyl)methyl]-N-(2-methylprop-2-enyl)carbamimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | C=C(C)CN/C(=N\Cc1ccc(Br)cc1C)NCC(=O)N(C)C |
| InChI | InChI=1S/C17H25BrN4O/c1-12(2)9-19-17(21-11-16(23)22(4)5)20-10-14-6-7-15(18)8-13(14)3/h6-8H,1,9-11H2,2-5H3,(H2,19,20,21) |
| InChIKey | PMLDUHKBEOBPQZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|