C17H24F3IN4O — CID 111363748
N,N-dimethyl-2-[[N-(2-methylprop-2-enyl)-N'-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 111363748) has the molecular formula C17H24F3IN4O and a molecular weight of 484.30 g/mol. Its IUPAC name is N,N-dimethyl-2-[[N-(2-methylprop-2-enyl)-N'-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[N-(2-methylprop-2-enyl)-N'-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111363748 |
| Molecular Formula | C17H24F3IN4O |
| Molecular Weight | 484.30 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | N,N-dimethyl-2-[[N-(2-methylprop-2-enyl)-N'-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | C=C(C)CN/C(=N\Cc1ccc(C(F)(F)F)cc1)NCC(=O)N(C)C.I |
| InChI | InChI=1S/C17H23F3N4O.HI/c1-12(2)9-21-16(23-11-15(25)24(3)4)22-10-13-5-7-14(8-6-13)17(18,19)20;/h5-8H,1,9-11H2,2-4H3,(H2,21,22,23);1H |
| InChIKey | HCHHAPCATUZCAO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.30 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|