C17H27IN4O — CID 111359571
N,N-dimethyl-2-[[N'-[(2-methylphenyl)methyl]-N-(2-methylprop-2-enyl)carbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 111359571) has the molecular formula C17H27IN4O and a molecular weight of 430.33 g/mol. Its IUPAC name is N,N-dimethyl-2-[[N'-[(2-methylphenyl)methyl]-N-(2-methylprop-2-enyl)carbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[N'-[(2-methylphenyl)methyl]-N-(2-methylprop-2-enyl)carbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111359571 |
| Molecular Formula | C17H27IN4O |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | N,N-dimethyl-2-[[N'-[(2-methylphenyl)methyl]-N-(2-methylprop-2-enyl)carbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | C=C(C)CN/C(=N\Cc1ccccc1C)NCC(=O)N(C)C.I |
| InChI | InChI=1S/C17H26N4O.HI/c1-13(2)10-18-17(20-12-16(22)21(4)5)19-11-15-9-7-6-8-14(15)3;/h6-9H,1,10-12H2,2-5H3,(H2,18,19,20);1H |
| InChIKey | KRRHMIMIOIWNQU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|