C19H27FN4O2S2 — CID 111625250
1-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-methylguanidine (PubChem CID 111625250) has the molecular formula C19H27FN4O2S2 and a molecular weight of 426.58 g/mol. Its IUPAC name is 1-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-methylguanidine.
| Compound Name | 1-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111625250 |
| Molecular Formula | C19H27FN4O2S2 |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 1-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1ccc(S(=O)(=O)N(C)C)s1)NCC(C)(C)c1cccc(F)c1 |
| InChI | InChI=1S/C19H27FN4O2S2/c1-19(2,14-7-6-8-15(20)11-14)13-23-18(21-3)22-12-16-9-10-17(27-16)28(25,26)24(4)5/h6-11H,12-13H2,1-5H3,(H2,21,22,23) |
| InChIKey | HBTBSLWSRKYLLP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|