C19H34FIN4 — CID 111624775
1-[3-(dimethylamino)-2,2-dimethylpropyl]-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-methylguanidine;hydroiodide (PubChem CID 111624775) has the molecular formula C19H34FIN4 and a molecular weight of 464.41 g/mol. Its IUPAC name is 1-[3-(dimethylamino)-2,2-dimethylpropyl]-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[3-(dimethylamino)-2,2-dimethylpropyl]-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111624775 |
| Molecular Formula | C19H34FIN4 |
| Molecular Weight | 464.41 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 1-[3-(dimethylamino)-2,2-dimethylpropyl]-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCC(C)(C)CN(C)C)NCC(C)(C)c1cccc(F)c1.I |
| InChI | InChI=1S/C19H33FN4.HI/c1-18(2,14-24(6)7)12-22-17(21-5)23-13-19(3,4)15-9-8-10-16(20)11-15;/h8-11H,12-14H2,1-7H3,(H2,21,22,23);1H |
| InChIKey | CCNSIASQYKCRGD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|