C18H28F4N4 — CID 111625148
1-[2-(3-fluorophenyl)-2-methylpropyl]-2-methyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine (PubChem CID 111625148) has the molecular formula C18H28F4N4 and a molecular weight of 376.44 g/mol. Its IUPAC name is 1-[2-(3-fluorophenyl)-2-methylpropyl]-2-methyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine.
| Compound Name | 1-[2-(3-fluorophenyl)-2-methylpropyl]-2-methyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine |
|---|---|
| PubChem CID | 111625148 |
| Molecular Formula | C18H28F4N4 |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 1-[2-(3-fluorophenyl)-2-methylpropyl]-2-methyl-3-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]guanidine |
| SMILES | C/N=C(\NCCCN(C)CC(F)(F)F)NCC(C)(C)c1cccc(F)c1 |
| InChI | InChI=1S/C18H28F4N4/c1-17(2,14-7-5-8-15(19)11-14)12-25-16(23-3)24-9-6-10-26(4)13-18(20,21)22/h5,7-8,11H,6,9-10,12-13H2,1-4H3,(H2,23,24,25) |
| InChIKey | PAXIFXAYTQKRBT-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|