C15H26FIN4O2S — CID 111625101
1-[2-(3-fluorophenyl)-2-methylpropyl]-3-[2-(methanesulfonamido)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111625101) has the molecular formula C15H26FIN4O2S and a molecular weight of 472.37 g/mol. Its IUPAC name is 1-[2-(3-fluorophenyl)-2-methylpropyl]-3-[2-(methanesulfonamido)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(3-fluorophenyl)-2-methylpropyl]-3-[2-(methanesulfonamido)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111625101 |
| Molecular Formula | C15H26FIN4O2S |
| Molecular Weight | 472.37 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | 1-[2-(3-fluorophenyl)-2-methylpropyl]-3-[2-(methanesulfonamido)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCNS(C)(=O)=O)NCC(C)(C)c1cccc(F)c1.I |
| InChI | InChI=1S/C15H25FN4O2S.HI/c1-15(2,12-6-5-7-13(16)10-12)11-19-14(17-3)18-8-9-20-23(4,21)22;/h5-7,10,20H,8-9,11H2,1-4H3,(H2,17,18,19);1H |
| InChIKey | XDSGTVACMCLEOA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.37 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|