C22H26FIN4O2 — CID 111624633
1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-methylguanidine;hydroiodide (PubChem CID 111624633) has the molecular formula C22H26FIN4O2 and a molecular weight of 524.38 g/mol. Its IUPAC name is 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111624633 |
| Molecular Formula | C22H26FIN4O2 |
| Molecular Weight | 524.38 g/mol |
| Exact Mass | 524.11 |
| IUPAC Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCN1C(=O)c2ccccc2C1=O)NCC(C)(C)c1cccc(F)c1.I |
| InChI | InChI=1S/C22H25FN4O2.HI/c1-22(2,15-7-6-8-16(23)13-15)14-26-21(24-3)25-11-12-27-19(28)17-9-4-5-10-18(17)20(27)29;/h4-10,13H,11-12,14H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | YNWGZDYYOPTLDT-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|