C20H22FIN4O2 — CID 111362950
1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-[2-(2-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111362950) has the molecular formula C20H22FIN4O2 and a molecular weight of 496.32 g/mol. Its IUPAC name is 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-[2-(2-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-[2-(2-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111362950 |
| Molecular Formula | C20H22FIN4O2 |
| Molecular Weight | 496.32 g/mol |
| Exact Mass | 496.08 |
| IUPAC Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-[2-(2-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccccc1F)NCCN1C(=O)c2ccccc2C1=O.I |
| InChI | InChI=1S/C20H21FN4O2.HI/c1-22-20(23-11-10-14-6-2-5-9-17(14)21)24-12-13-25-18(26)15-7-3-4-8-16(15)19(25)27;/h2-9H,10-13H2,1H3,(H2,22,23,24);1H |
| InChIKey | KVJPAZGQHAGVAK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|