C23H32FIN4O2 — CID 111625679
2-[3-[[[N-[2-(3-fluorophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111625679) has the molecular formula C23H32FIN4O2 and a molecular weight of 542.44 g/mol. Its IUPAC name is 2-[3-[[[N-[2-(3-fluorophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[3-[[[N-[2-(3-fluorophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111625679 |
| Molecular Formula | C23H32FIN4O2 |
| Molecular Weight | 542.44 g/mol |
| Exact Mass | 542.16 |
| IUPAC Name | 2-[3-[[[N-[2-(3-fluorophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]methyl]phenoxy]-N,N-dimethylacetamide;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(OCC(=O)N(C)C)c1)NCC(C)(C)c1cccc(F)c1.I |
| InChI | InChI=1S/C23H31FN4O2.HI/c1-23(2,18-9-7-10-19(24)13-18)16-27-22(25-3)26-14-17-8-6-11-20(12-17)30-15-21(29)28(4)5;/h6-13H,14-16H2,1-5H3,(H2,25,26,27);1H |
| InChIKey | TUOFCYXDMVGDPC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|