C20H28FIN4O — CID 111625421
1-[(2-ethoxy-4-pyridinyl)methyl]-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-methylguanidine;hydroiodide (PubChem CID 111625421) has the molecular formula C20H28FIN4O and a molecular weight of 486.37 g/mol. Its IUPAC name is 1-[(2-ethoxy-4-pyridinyl)methyl]-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(2-ethoxy-4-pyridinyl)methyl]-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111625421 |
| Molecular Formula | C20H28FIN4O |
| Molecular Weight | 486.37 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | 1-[(2-ethoxy-4-pyridinyl)methyl]-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-methylguanidine;hydroiodide |
| SMILES | CCOc1cc(CN/C(=N\C)NCC(C)(C)c2cccc(F)c2)ccn1.I |
| InChI | InChI=1S/C20H27FN4O.HI/c1-5-26-18-11-15(9-10-23-18)13-24-19(22-4)25-14-20(2,3)16-7-6-8-17(21)12-16;/h6-12H,5,13-14H2,1-4H3,(H2,22,24,25);1H |
| InChIKey | OUYMPYYFRZIZBY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|