C19H27IN4O3S2 — CID 109481186
N-ethyl-2-(2-methylphenyl)-N'-[(5-sulfamoylthiophen-2-yl)methyl]morpholine-4-carboximidamide;hydroiodide (PubChem CID 109481186) has the molecular formula C19H27IN4O3S2 and a molecular weight of 550.49 g/mol. Its IUPAC name is N-ethyl-2-(2-methylphenyl)-N'-[(5-sulfamoylthiophen-2-yl)methyl]morpholine-4-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-2-(2-methylphenyl)-N'-[(5-sulfamoylthiophen-2-yl)methyl]morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109481186 |
| Molecular Formula | C19H27IN4O3S2 |
| Molecular Weight | 550.49 g/mol |
| Exact Mass | 550.06 |
| IUPAC Name | N-ethyl-2-(2-methylphenyl)-N'-[(5-sulfamoylthiophen-2-yl)methyl]morpholine-4-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(S(N)(=O)=O)s1)N1CCOC(c2ccccc2C)C1.I |
| InChI | InChI=1S/C19H26N4O3S2.HI/c1-3-21-19(22-12-15-8-9-18(27-15)28(20,24)25)23-10-11-26-17(13-23)16-7-5-4-6-14(16)2;/h4-9,17H,3,10-13H2,1-2H3,(H,21,22)(H2,20,24,25);1H |
| InChIKey | RRGFVNLCVXUKIB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|